C33H29N3O3 — CID 101491322
2-[2-[(E)-2-[4-[bis(2-hydroxyethyl)amino]-2-(4-phenylphenyl)phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile (PubChem CID 101491322) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-[bis(2-hydroxyethyl)amino]-2-(4-phenylphenyl)phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-[4-[bis(2-hydroxyethyl)amino]-2-(4-phenylphenyl)phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 101491322 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-[2-[(E)-2-[4-[bis(2-hydroxyethyl)amino]-2-(4-phenylphenyl)phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(/C=C/c2ccc(N(CCO)CCO)cc2-c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C33H29N3O3/c1-24-19-29(30(22-34)23-35)20-32(39-24)14-12-28-11-13-31(36(15-17-37)16-18-38)21-33(28)27-9-7-26(8-10-27)25-5-3-2-4-6-25/h2-14,19-21,37-38H,15-18H2,1H3/b14-12+ |
| InChIKey | XSXQFUOJSPQYEE-WYMLVPIESA-N |
| XLogP | 5.99 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|