C27H18N2O2 — CID 91744793
2-[2-[(2,6-diphenylpyran-4-ylidene)methyl]-6-methylpyran-4-ylidene]propanedinitrile (PubChem CID 91744793) has the molecular formula C27H18N2O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[2-[(2,6-diphenylpyran-4-ylidene)methyl]-6-methylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(2,6-diphenylpyran-4-ylidene)methyl]-6-methylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 91744793 |
| Molecular Formula | C27H18N2O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[2-[(2,6-diphenylpyran-4-ylidene)methyl]-6-methylpyran-4-ylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(C=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)O1 |
| InChI | InChI=1S/C27H18N2O2/c1-19-12-23(24(17-28)18-29)16-25(30-19)13-20-14-26(21-8-4-2-5-9-21)31-27(15-20)22-10-6-3-7-11-22/h2-16H,1H3 |
| InChIKey | RGFBCVFRSGCAAK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|