C22H19N3O6 — CID 132991852
2-[carboxymethyl-[[5-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-2-hydroxyphenyl]methyl]amino]acetic acid (PubChem CID 132991852) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-[carboxymethyl-[[5-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-2-hydroxyphenyl]methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[[5-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-2-hydroxyphenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 132991852 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[carboxymethyl-[[5-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-2-hydroxyphenyl]methyl]amino]acetic acid |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(/C=C/c2ccc(O)c(CN(CC(=O)O)CC(=O)O)c2)O1 |
| InChI | InChI=1S/C22H19N3O6/c1-14-6-16(18(9-23)10-24)8-19(31-14)4-2-15-3-5-20(26)17(7-15)11-25(12-21(27)28)13-22(29)30/h2-8,26H,11-13H2,1H3,(H,27,28)(H,29,30)/b4-2+ |
| InChIKey | XDEWSGKQSJIRBQ-DUXPYHPUSA-N |
| XLogP | 2.54 |
| TPSA | 154.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|