C38H24N2O3 — CID 176652862
2-[2,6-bis[4-(3-methyl-1-benzofuran-2-yl)phenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 176652862) has the molecular formula C38H24N2O3 and a molecular weight of 556.62 g/mol. Its IUPAC name is 2-[2,6-bis[4-(3-methyl-1-benzofuran-2-yl)phenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2,6-bis[4-(3-methyl-1-benzofuran-2-yl)phenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 176652862 |
| Molecular Formula | C38H24N2O3 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-[2,6-bis[4-(3-methyl-1-benzofuran-2-yl)phenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | Cc1c(-c2ccc(C3=CC(=C(C#N)C#N)C=C(c4ccc(-c5oc6ccccc6c5C)cc4)O3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C38H24N2O3/c1-23-31-7-3-5-9-33(31)42-37(23)27-15-11-25(12-16-27)35-19-29(30(21-39)22-40)20-36(41-35)26-13-17-28(18-14-26)38-24(2)32-8-4-6-10-34(32)43-38/h3-20H,1-2H3 |
| InChIKey | LWVQCLLDNGDKDU-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 83.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|