C34H25N3O — CID 101254090
2-[6,7-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile (PubChem CID 101254090) has the molecular formula C34H25N3O and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[6,7-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile.
| Compound Name | 2-[6,7-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 101254090 |
| Molecular Formula | C34H25N3O |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[6,7-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile |
| SMILES | Cc1cc2c(cc1C)C(=C(C#N)C#N)C=C(/C=C/c1ccc(N(c3ccccc3)c3ccccc3)cc1)O2 |
| InChI | InChI=1S/C34H25N3O/c1-24-19-33-32(27(22-35)23-36)21-31(38-34(33)20-25(24)2)18-15-26-13-16-30(17-14-26)37(28-9-5-3-6-10-28)29-11-7-4-8-12-29/h3-21H,1-2H3/b18-15+ |
| InChIKey | CMSXJNBDRDJFKQ-OBGWFSINSA-N |
| XLogP | 8.56 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|