C56H63N3O — CID 102485589
2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(3,7-ditert-butylnaphthalen-1-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile (PubChem CID 102485589) has the molecular formula C56H63N3O and a molecular weight of 794.14 g/mol. Its IUPAC name is 2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(3,7-ditert-butylnaphthalen-1-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile.
| Compound Name | 2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(3,7-ditert-butylnaphthalen-1-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102485589 |
| Molecular Formula | C56H63N3O |
| Molecular Weight | 794.14 g/mol |
| Exact Mass | 793.50 |
| IUPAC Name | 2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(3,7-ditert-butylnaphthalen-1-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(/C=C/C3=CC(=C(C#N)C#N)c4cc(C(C)(C)C)cc(C(C)(C)C)c4O3)cc2)c2cc(C(C)(C)C)cc3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C56H63N3O/c1-52(2,3)39-21-25-44(26-22-39)59(50-32-41(54(7,8)9)28-37-19-20-40(29-47(37)50)53(4,5)6)43-23-16-36(17-24-43)18-27-45-33-46(38(34-57)35-58)48-30-42(55(10,11)12)31-49(51(48)60-45)56(13,14)15/h16-33H,1-15H3/b27-18+ |
| InChIKey | HEWUZUVMXLUXRO-OVVQPSECSA-N |
| XLogP | 15.59 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.14 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|