C44H34N2O2 — CID 59449275
(Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-pyren-2-ylanilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 59449275) has the molecular formula C44H34N2O2 and a molecular weight of 622.77 g/mol. Its IUPAC name is (Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-pyren-2-ylanilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-pyren-2-ylanilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 59449275 |
| Molecular Formula | C44H34N2O2 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | (Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-pyren-2-ylanilino)phenyl]ethenyl]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(/C=C/c3ccc(/C=C(/C#N)C(=O)O)cc3)cc2)c2cc3ccc4cccc5ccc(c2)c3c45)cc1 |
| InChI | InChI=1S/C44H34N2O2/c1-44(2,3)37-19-23-39(24-20-37)46(40-26-34-17-15-32-5-4-6-33-16-18-35(27-40)42(34)41(32)33)38-21-13-30(14-22-38)8-7-29-9-11-31(12-10-29)25-36(28-45)43(47)48/h4-27H,1-3H3,(H,47,48)/b8-7+,36-25- |
| InChIKey | VTIOZGNYRYJDCE-WVUJSFFDSA-N |
| XLogP | 11.51 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|