C32H20N2O2 — CID 139256339
(E)-2-cyano-3-[3-(N-pyren-1-ylanilino)phenyl]prop-2-enoic acid (PubChem CID 139256339) has the molecular formula C32H20N2O2 and a molecular weight of 464.52 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-(N-pyren-1-ylanilino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[3-(N-pyren-1-ylanilino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139256339 |
| Molecular Formula | C32H20N2O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (E)-2-cyano-3-[3-(N-pyren-1-ylanilino)phenyl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1cccc(N(c2ccccc2)c2ccc3ccc4cccc5ccc2c3c45)c1)C(=O)O |
| InChI | InChI=1S/C32H20N2O2/c33-20-25(32(35)36)18-21-6-4-11-27(19-21)34(26-9-2-1-3-10-26)29-17-15-24-13-12-22-7-5-8-23-14-16-28(29)31(24)30(22)23/h1-19H,(H,35,36)/b25-18+ |
| InChIKey | OBOFVGNMFIBGHK-XIEYBQDHSA-N |
| XLogP | 8.05 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|