C35H30N2O2S2 — CID 177450929
(Z)-3-[5-[5-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 177450929) has the molecular formula C35H30N2O2S2 and a molecular weight of 574.77 g/mol. Its IUPAC name is (Z)-3-[5-[5-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[5-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 177450929 |
| Molecular Formula | C35H30N2O2S2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | (Z)-3-[5-[5-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | Cc1ccc(N(c2ccc(-c3ccc(-c4ccc(/C=C(/C#N)C(=O)O)s4)s3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H30N2O2S2/c1-23-5-11-27(12-6-23)37(29-15-9-26(10-16-29)35(2,3)4)28-13-7-24(8-14-28)31-19-20-33(41-31)32-18-17-30(40-32)21-25(22-36)34(38)39/h5-21H,1-4H3,(H,38,39)/b25-21- |
| InChIKey | YCDMCOJWMMNNEF-DAFNUICNSA-N |
| XLogP | 10.21 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|