C60H60N2O2S2 — CID 76609697
3-[5-[5-[4-[bis(9,9-ditert-butylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 76609697) has the molecular formula C60H60N2O2S2 and a molecular weight of 905.29 g/mol. Its IUPAC name is 3-[5-[5-[4-[bis(9,9-ditert-butylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[5-[5-[4-[bis(9,9-ditert-butylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 76609697 |
| Molecular Formula | C60H60N2O2S2 |
| Molecular Weight | 905.29 g/mol |
| Exact Mass | 904.41 |
| IUPAC Name | 3-[5-[5-[4-[bis(9,9-ditert-butylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CC(C)(C)C1(C(C)(C)C)c2ccccc2-c2ccc(N(c3ccc(-c4ccc(-c5ccc(C=C(C#N)C(=O)O)s5)s4)cc3)c3ccc4c(c3)C(C(C)(C)C)(C(C)(C)C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C60H60N2O2S2/c1-55(2,3)59(56(4,5)6)47-19-15-13-17-43(47)45-28-25-40(34-49(45)59)62(41-26-29-46-44-18-14-16-20-48(44)60(50(46)35-41,57(7,8)9)58(10,11)12)39-23-21-37(22-24-39)51-31-32-53(66-51)52-30-27-42(65-52)33-38(36-61)54(63)64/h13-35H,1-12H3,(H,63,64) |
| InChIKey | ZSOABBOXBKDTEB-UHFFFAOYSA-N |
| XLogP | 17.32 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.29 |
| LogP ≤ 5 | 17.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|