C59H65N3O — CID 102452939
2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(2-tert-butyl-9,9-diethylfluoren-4-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile (PubChem CID 102452939) has the molecular formula C59H65N3O and a molecular weight of 832.19 g/mol. Its IUPAC name is 2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(2-tert-butyl-9,9-diethylfluoren-4-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile.
| Compound Name | 2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(2-tert-butyl-9,9-diethylfluoren-4-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102452939 |
| Molecular Formula | C59H65N3O |
| Molecular Weight | 832.19 g/mol |
| Exact Mass | 831.51 |
| IUPAC Name | 2-[6,8-ditert-butyl-2-[(E)-2-[4-(4-tert-butyl-N-(2-tert-butyl-9,9-diethylfluoren-4-yl)anilino)phenyl]ethenyl]chromen-4-ylidene]propanedinitrile |
| SMILES | CCC1(CC)c2ccccc2-c2c(N(c3ccc(/C=C/C4=CC(=C(C#N)C#N)c5cc(C(C)(C)C)cc(C(C)(C)C)c5O4)cc3)c3ccc(C(C)(C)C)cc3)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C59H65N3O/c1-15-59(16-2)49-20-18-17-19-46(49)53-50(59)32-42(57(9,10)11)34-52(53)62(44-28-24-40(25-29-44)55(3,4)5)43-26-21-38(22-27-43)23-30-45-35-47(39(36-60)37-61)48-31-41(56(6,7)8)33-51(54(48)63-45)58(12,13)14/h17-35H,15-16H2,1-14H3/b30-23+ |
| InChIKey | IUAVKCHCAQNQDU-JJKYIXSRSA-N |
| XLogP | 16.22 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.19 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|