C25H29N3O — CID 20778341
(2E)-2-[2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 20778341) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is (2E)-2-[2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 20778341 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | (2E)-2-[2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(C)OC(/C=C/c2ccc(N(CCCC)CCCC)cc2)=C1 |
| InChI | InChI=1S/C25H29N3O/c1-5-7-15-28(16-8-6-2)23-12-9-21(10-13-23)11-14-24-18-22(17-20(3)29-24)25(19-26)27-4/h9-14,17-18H,5-8,15-16H2,1-3H3/b14-11+,25-22+ |
| InChIKey | FQUVNZQKMCXBQC-CSIAADISSA-N |
| XLogP | 6.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|