C31H26N4O3 — CID 59911660
(2E)-2-[2-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 59911660) has the molecular formula C31H26N4O3 and a molecular weight of 502.57 g/mol. Its IUPAC name is (2E)-2-[2-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[2-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59911660 |
| Molecular Formula | C31H26N4O3 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (2E)-2-[2-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2ccc(N(C)C)cc2)OC(/C=C/c2cc3ccc(N(C)C)cc3oc2=O)=C1 |
| InChI | InChI=1S/C31H26N4O3/c1-33-29(20-32)24-17-27(14-8-21-6-11-25(12-7-21)34(2)3)37-28(18-24)15-10-23-16-22-9-13-26(35(4)5)19-30(22)38-31(23)36/h6-19H,2-5H3/b14-8+,15-10+,29-24+ |
| InChIKey | BVFNQVZCGZDSQE-GOUGGUAQSA-N |
| XLogP | 6.15 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|