C35H30N4O3 — CID 142016274
2-[2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 142016274) has the molecular formula C35H30N4O3 and a molecular weight of 554.65 g/mol. Its IUPAC name is 2-[2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 142016274 |
| Molecular Formula | C35H30N4O3 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-[2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-[7-(dimethylamino)-2-oxochromen-3-yl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc2cc(/C=C/C3=CC(=C(C#N)C#N)C=C(/C=C/c4cc5c6c(c4)CCCN6CCC5)O3)c(=O)oc2c1 |
| InChI | InChI=1S/C35H30N4O3/c1-38(2)30-10-8-24-17-27(35(40)42-33(24)20-30)9-12-32-19-28(29(21-36)22-37)18-31(41-32)11-7-23-15-25-5-3-13-39-14-4-6-26(16-23)34(25)39/h7-12,15-20H,3-6,13-14H2,1-2H3/b11-7+,12-9+ |
| InChIKey | LADMVHBLPUOBQN-HNWKWBPYSA-N |
| XLogP | 6.43 |
| TPSA | 93.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|