C28H23N3O3 — CID 123147724
(2Z)-2-[2-tert-butyl-6-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 123147724) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2Z)-2-[2-tert-butyl-6-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[2-tert-butyl-6-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 123147724 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (2Z)-2-[2-tert-butyl-6-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(/C=C/c2cc3cc4c(cc3oc2=O)C#CCCNC4)OC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C28H23N3O3/c1-28(2,3)26-15-20(24(16-29)30-4)13-23(33-26)9-8-19-11-21-12-22-17-31-10-6-5-7-18(22)14-25(21)34-27(19)32/h8-9,11-15,31H,6,10,17H2,1-3H3/b9-8+,24-20- |
| InChIKey | HLSSELDUMAKKBH-BTFPLGGSSA-N |
| XLogP | 5.19 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|