C42H38N4O — CID 91435634
2-[2,6-bis[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile;ethane (PubChem CID 91435634) has the molecular formula C42H38N4O and a molecular weight of 614.79 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile;ethane.
| Compound Name | 2-[2,6-bis[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile;ethane |
|---|---|
| PubChem CID | 91435634 |
| Molecular Formula | C42H38N4O |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | 2-[2,6-bis[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile;ethane |
| SMILES | CC.CC.[C-]#[N+]C(C#N)=C1C=C(/C=C/c2ccc3c(c2)c2ccccc2n3C)OC(/C=C/c2ccc3c(c2)c2ccccc2n3C)=C1 |
| InChI | InChI=1S/C38H26N4O.2C2H6/c1-40-34(24-39)27-22-28(16-12-25-14-18-37-32(20-25)30-8-4-6-10-35(30)41(37)2)43-29(23-27)17-13-26-15-19-38-33(21-26)31-9-5-7-11-36(31)42(38)3;2*1-2/h4-23H,2-3H3;2*1-2H3/b16-12+,17-13+;; |
| InChIKey | MONYDVJSZCBPLO-AZMAMVBESA-N |
| XLogP | 11.25 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|