C29H33N3O — CID 59687697
(2Z)-2-isocyano-2-[2-propan-2-yl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile (PubChem CID 59687697) has the molecular formula C29H33N3O and a molecular weight of 439.60 g/mol. Its IUPAC name is (2Z)-2-isocyano-2-[2-propan-2-yl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile.
| Compound Name | (2Z)-2-isocyano-2-[2-propan-2-yl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 59687697 |
| Molecular Formula | C29H33N3O |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (2Z)-2-isocyano-2-[2-propan-2-yl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)OC(C(C)C)=C1 |
| InChI | InChI=1S/C29H33N3O/c1-19(2)26-17-21(25(18-30)31-7)16-22(33-26)9-8-20-14-23-27-24(15-20)29(5,6)11-13-32(27)12-10-28(23,3)4/h8-9,14-17,19H,10-13H2,1-6H3/b9-8+,25-21+ |
| InChIKey | NZLZCWBBIWUKIL-HZOBEKRDSA-N |
| XLogP | 7.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|