C32H31N3O — CID 59918809
(2E)-2-isocyano-2-[2-phenyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile (PubChem CID 59918809) has the molecular formula C32H31N3O and a molecular weight of 473.62 g/mol. Its IUPAC name is (2E)-2-isocyano-2-[2-phenyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile.
| Compound Name | (2E)-2-isocyano-2-[2-phenyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 59918809 |
| Molecular Formula | C32H31N3O |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (2E)-2-isocyano-2-[2-phenyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C32H31N3O/c1-31(2)13-15-35-16-14-32(3,4)27-18-22(17-26(31)30(27)35)11-12-25-19-24(28(21-33)34-5)20-29(36-25)23-9-7-6-8-10-23/h6-12,17-20H,13-16H2,1-4H3/b12-11+,28-24+ |
| InChIKey | HZDOWLKSSXNTIZ-BFHDZJHJSA-N |
| XLogP | 7.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|