C35H31N3O2 — CID 147367501
2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile (PubChem CID 147367501) has the molecular formula C35H31N3O2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 147367501 |
| Molecular Formula | C35H31N3O2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile |
| SMILES | COc1cc(/C=C/C2=CC(=C(C#N)C#N)C=C(c3ccccc3)O2)cc2c1N(Cc1ccccc1)CCC2(C)C |
| InChI | InChI=1S/C35H31N3O2/c1-35(2)16-17-38(24-25-10-6-4-7-11-25)34-31(35)18-26(19-33(34)39-3)14-15-30-20-28(29(22-36)23-37)21-32(40-30)27-12-8-5-9-13-27/h4-15,18-21H,16-17,24H2,1-3H3/b15-14+ |
| InChIKey | DILPNJCXVPUEKV-CCEZHUSRSA-N |
| XLogP | 7.70 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|