C14H19NO2 — CID 22635202
8-methoxy-1,4,4-trimethyl-2,3-dihydroquinoline-6-carbaldehyde (PubChem CID 22635202) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 8-methoxy-1,4,4-trimethyl-2,3-dihydroquinoline-6-carbaldehyde.
| Compound Name | 8-methoxy-1,4,4-trimethyl-2,3-dihydroquinoline-6-carbaldehyde |
|---|---|
| PubChem CID | 22635202 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 8-methoxy-1,4,4-trimethyl-2,3-dihydroquinoline-6-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1N(C)CCC2(C)C |
| InChI | InChI=1S/C14H19NO2/c1-14(2)5-6-15(3)13-11(14)7-10(9-16)8-12(13)17-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | PWGKLJWGDYDWSF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|