C30H33N3O — CID 76724294
2-[2-but-3-enyl-6-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 76724294) has the molecular formula C30H33N3O and a molecular weight of 451.61 g/mol. Its IUPAC name is 2-[2-but-3-enyl-6-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2-but-3-enyl-6-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 76724294 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 2-[2-but-3-enyl-6-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C=Cc2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)OC(CCC=C)=C1 |
| InChI | InChI=1S/C30H33N3O/c1-7-8-9-23-18-22(27(20-31)32-6)19-24(34-23)11-10-21-16-25-28-26(17-21)30(4,5)13-15-33(28)14-12-29(25,2)3/h7,10-11,16-19H,1,8-9,12-15H2,2-5H3 |
| InChIKey | HXPVPFNZUSHFOI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|