C30H41NO — CID 172747551
7-[2-(6-tert-butyl-4-propylidenepyran-2-yl)ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 172747551) has the molecular formula C30H41NO and a molecular weight of 431.66 g/mol. Its IUPAC name is 7-[2-(6-tert-butyl-4-propylidenepyran-2-yl)ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
| Compound Name | 7-[2-(6-tert-butyl-4-propylidenepyran-2-yl)ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
|---|---|
| PubChem CID | 172747551 |
| Molecular Formula | C30H41NO |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | 7-[2-(6-tert-butyl-4-propylidenepyran-2-yl)ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | CCC=C1C=C(C=Cc2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)OC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C30H41NO/c1-9-10-21-17-23(32-26(20-21)28(2,3)4)12-11-22-18-24-27-25(19-22)30(7,8)14-16-31(27)15-13-29(24,5)6/h10-12,17-20H,9,13-16H2,1-8H3 |
| InChIKey | JXVJDYSSKSDYNM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|