C20H23N3 — CID 168550530
2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]propanedinitrile (PubChem CID 168550530) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168550530 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]propanedinitrile |
| SMILES | CC1(C)CCN2CCC(C)(C)c3cc(C=C(C#N)C#N)cc1c32 |
| InChI | InChI=1S/C20H23N3/c1-19(2)5-7-23-8-6-20(3,4)17-11-14(9-15(12-21)13-22)10-16(19)18(17)23/h9-11H,5-8H2,1-4H3 |
| InChIKey | HTPLVNJXCOSJAW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|