C25H29NO — CID 20721534
1-phenyl-1-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)prop-2-yn-1-ol (PubChem CID 20721534) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-phenyl-1-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)prop-2-yn-1-ol.
| Compound Name | 1-phenyl-1-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 20721534 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-phenyl-1-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)prop-2-yn-1-ol |
| SMILES | C#CC(O)(c1ccccc1)c1cc2c3c(c1)C(C)(C)CCN3CCC2(C)C |
| InChI | InChI=1S/C25H29NO/c1-6-25(27,18-10-8-7-9-11-18)19-16-20-22-21(17-19)24(4,5)13-15-26(22)14-12-23(20,2)3/h1,7-11,16-17,27H,12-15H2,2-5H3 |
| InChIKey | QBQQTNZDLULPMS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|