C24H29NO4 — CID 155322123
2-[hydroxy-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methyl]benzoic acid (PubChem CID 155322123) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[hydroxy-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methyl]benzoic acid.
| Compound Name | 2-[hydroxy-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 155322123 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[hydroxy-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methyl]benzoic acid |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c(O)c(C(O)c4ccccc4C(=O)O)cc1c32 |
| InChI | InChI=1S/C24H29NO4/c1-23(2)9-11-25-12-10-24(3,4)18-19(25)17(23)13-16(21(18)27)20(26)14-7-5-6-8-15(14)22(28)29/h5-8,13,20,26-27H,9-12H2,1-4H3,(H,28,29) |
| InChIKey | RDPZIGYVXQRAAH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|