C18H27N5 — CID 168592967
2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylideneamino]guanidine (PubChem CID 168592967) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylideneamino]guanidine.
| Compound Name | 2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592967 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 2-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylideneamino]guanidine |
| SMILES | CC1(C)CCN2CCC(C)(C)c3cc(C=NN=C(N)N)cc1c32 |
| InChI | InChI=1S/C18H27N5/c1-17(2)5-7-23-8-6-18(3,4)14-10-12(9-13(17)15(14)23)11-21-22-16(19)20/h9-11H,5-8H2,1-4H3,(H4,19,20,22) |
| InChIKey | FPWQJIZTGPIODU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|