C22H26N4O3 — CID 123511294
2-(hydroxymethoxy)-5-isocyano-4-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]pyrazol-3-one (PubChem CID 123511294) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-(hydroxymethoxy)-5-isocyano-4-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]pyrazol-3-one.
| Compound Name | 2-(hydroxymethoxy)-5-isocyano-4-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 123511294 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-(hydroxymethoxy)-5-isocyano-4-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]pyrazol-3-one |
| SMILES | [C-]#[N+]C1=NN(OCO)C(=O)C1=Cc1cc2c3c(c1)C(C)(C)CCN3CCC2(C)C |
| InChI | InChI=1S/C22H26N4O3/c1-21(2)6-8-25-9-7-22(3,4)17-12-14(11-16(21)18(17)25)10-15-19(23-5)24-26(20(15)28)29-13-27/h10-12,27H,6-9,13H2,1-4H3 |
| InChIKey | WGWRSHAJMRUHOL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|