C17H9Cl2N3O2 — CID 136651103
4-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-isocyano-2-phenylpyrazol-3-one (PubChem CID 136651103) has the molecular formula C17H9Cl2N3O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-isocyano-2-phenylpyrazol-3-one.
| Compound Name | 4-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-isocyano-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 136651103 |
| Molecular Formula | C17H9Cl2N3O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 4-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-isocyano-2-phenylpyrazol-3-one |
| SMILES | [C-]#[N+]C1=NN(c2ccccc2)C(=O)C1=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2N3O2/c1-20-16-12(7-10-8-13(18)15(23)14(19)9-10)17(24)22(21-16)11-5-3-2-4-6-11/h2-9,23H |
| InChIKey | CSJKMKHRPJHFAR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|