C22H25N2O3S2- — CID 59595397
2-[(5E)-4-oxo-2-sulfanylidene-5-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 59595397) has the molecular formula C22H25N2O3S2- and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[(5E)-4-oxo-2-sulfanylidene-5-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5E)-4-oxo-2-sulfanylidene-5-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 59595397 |
| Molecular Formula | C22H25N2O3S2- |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[(5E)-4-oxo-2-sulfanylidene-5-[(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC1(C)CCN2CCC(C)(C)c3cc(/C=C4/SC(=S)N(CC(=O)[O-])C4=O)cc1c32 |
| InChI | InChI=1S/C22H26N2O3S2/c1-21(2)5-7-23-8-6-22(3,4)15-10-13(9-14(21)18(15)23)11-16-19(27)24(12-17(25)26)20(28)29-16/h9-11H,5-8,12H2,1-4H3,(H,25,26)/p-1/b16-11+ |
| InChIKey | HKPADTXNHQAYAS-LFIBNONCSA-M |
| XLogP | 2.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|