C23H26N2O — CID 15508570
1,1-bis(4-pyrrolidin-1-ylphenyl)prop-2-yn-1-ol (PubChem CID 15508570) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 1,1-bis(4-pyrrolidin-1-ylphenyl)prop-2-yn-1-ol.
| Compound Name | 1,1-bis(4-pyrrolidin-1-ylphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 15508570 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1,1-bis(4-pyrrolidin-1-ylphenyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)(c1ccc(N2CCCC2)cc1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H26N2O/c1-2-23(26,19-7-11-21(12-8-19)24-15-3-4-16-24)20-9-13-22(14-10-20)25-17-5-6-18-25/h1,7-14,26H,3-6,15-18H2 |
| InChIKey | WTWGJNJCMWRLGU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|