C40H38N2O4 — CID 169006830
1-[4-[(E)-2-[4-[1-hydroxy-1-(4-morpholin-4-ylphenyl)prop-2-ynyl]phenyl]ethenyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-yn-1-ol (PubChem CID 169006830) has the molecular formula C40H38N2O4 and a molecular weight of 610.75 g/mol. Its IUPAC name is 1-[4-[(E)-2-[4-[1-hydroxy-1-(4-morpholin-4-ylphenyl)prop-2-ynyl]phenyl]ethenyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-yn-1-ol.
| Compound Name | 1-[4-[(E)-2-[4-[1-hydroxy-1-(4-morpholin-4-ylphenyl)prop-2-ynyl]phenyl]ethenyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169006830 |
| Molecular Formula | C40H38N2O4 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 1-[4-[(E)-2-[4-[1-hydroxy-1-(4-morpholin-4-ylphenyl)prop-2-ynyl]phenyl]ethenyl]phenyl]-1-(4-morpholin-4-ylphenyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)(c1ccc(/C=C/c2ccc(C(O)(C#C)c3ccc(N4CCOCC4)cc3)cc2)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C40H38N2O4/c1-3-39(43,35-15-19-37(20-16-35)41-23-27-45-28-24-41)33-11-7-31(8-12-33)5-6-32-9-13-34(14-10-32)40(44,4-2)36-17-21-38(22-18-36)42-25-29-46-30-26-42/h1-2,5-22,43-44H,23-30H2/b6-5+ |
| InChIKey | HJDOMRZYUMSFGF-AATRIKPKSA-N |
| XLogP | 5.27 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|