C20H23NO2 — CID 164970433
2,6-dimethyl-4-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]phenol (PubChem CID 164970433) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]phenol.
| Compound Name | 2,6-dimethyl-4-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 164970433 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2,6-dimethyl-4-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]phenol |
| SMILES | Cc1cc(/C=C/c2ccc(N3CCOCC3)cc2)cc(C)c1O |
| InChI | InChI=1S/C20H23NO2/c1-15-13-18(14-16(2)20(15)22)4-3-17-5-7-19(8-6-17)21-9-11-23-12-10-21/h3-8,13-14,22H,9-12H2,1-2H3/b4-3+ |
| InChIKey | SURMUEHUTBUIDA-ONEGZZNKSA-N |
| XLogP | 4.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|