C19H20FNO — CID 165080282
2-fluoro-6-methyl-4-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenol (PubChem CID 165080282) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-fluoro-6-methyl-4-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenol.
| Compound Name | 2-fluoro-6-methyl-4-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 165080282 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-fluoro-6-methyl-4-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenol |
| SMILES | Cc1cc(/C=C/c2ccc(N3CCCC3)cc2)cc(F)c1O |
| InChI | InChI=1S/C19H20FNO/c1-14-12-16(13-18(20)19(14)22)5-4-15-6-8-17(9-7-15)21-10-2-3-11-21/h4-9,12-13,22H,2-3,10-11H2,1H3/b5-4+ |
| InChIKey | NTRRFUSYAJSIBI-SNAWJCMRSA-N |
| XLogP | 4.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|