C26H24FN3O2 — CID 139552114
N-[(E)-[3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenyl]methylideneamino]benzamide (PubChem CID 139552114) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[(E)-[3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenyl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 139552114 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[(E)-[3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(/C=C/c2ccc(N3CCCC3)cc2)cc(F)c1O)c1ccccc1 |
| InChI | InChI=1S/C26H24FN3O2/c27-24-17-20(9-8-19-10-12-23(13-11-19)30-14-4-5-15-30)16-22(25(24)31)18-28-29-26(32)21-6-2-1-3-7-21/h1-3,6-13,16-18,31H,4-5,14-15H2,(H,29,32)/b9-8+,28-18+ |
| InChIKey | MRMGRDXRGHVJNT-VJNPKJHNSA-N |
| XLogP | 5.07 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|