C25H25N3O2 — CID 1281852
2-hydroxy-2,2-diphenyl-N-[(4-pyrrolidin-1-ylphenyl)methylideneamino]acetamide (PubChem CID 1281852) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenyl-N-[(4-pyrrolidin-1-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-hydroxy-2,2-diphenyl-N-[(4-pyrrolidin-1-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1281852 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-hydroxy-2,2-diphenyl-N-[(4-pyrrolidin-1-ylphenyl)methylideneamino]acetamide |
| SMILES | O=C(NN=Cc1ccc(N2CCCC2)cc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O2/c29-24(25(30,21-9-3-1-4-10-21)22-11-5-2-6-12-22)27-26-19-20-13-15-23(16-14-20)28-17-7-8-18-28/h1-6,9-16,19,30H,7-8,17-18H2,(H,27,29) |
| InChIKey | IGYVFOAQFTZLOQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|