C25H27N3O2 — CID 50854369
N-[(Z)-(1-cyclohexylpyrrol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 50854369) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[(Z)-(1-cyclohexylpyrrol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-(1-cyclohexylpyrrol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 50854369 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[(Z)-(1-cyclohexylpyrrol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1ccn(C2CCCCC2)c1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O2/c29-24(25(30,21-10-4-1-5-11-21)22-12-6-2-7-13-22)27-26-18-20-16-17-28(19-20)23-14-8-3-9-15-23/h1-2,4-7,10-13,16-19,23,30H,3,8-9,14-15H2,(H,27,29)/b26-18- |
| InChIKey | KUDYWDUEIGCVNQ-ITYLOYPMSA-N |
| XLogP | 4.38 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|