C22H23N5O — CID 140607598
(2E)-2-[4-[4-(dibutylamino)phenyl]-3-isocyano-5-oxopyrrol-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 140607598) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is (2E)-2-[4-[4-(dibutylamino)phenyl]-3-isocyano-5-oxopyrrol-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[4-[4-(dibutylamino)phenyl]-3-isocyano-5-oxopyrrol-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 140607598 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (2E)-2-[4-[4-(dibutylamino)phenyl]-3-isocyano-5-oxopyrrol-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(N(CCCC)CCCC)cc2)C(=O)N/C1=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C22H23N5O/c1-5-7-13-27(14-8-6-2)17-11-9-16(10-12-17)19-21(25-4)20(26-22(19)28)18(15-23)24-3/h9-12H,5-8,13-14H2,1-2H3,(H,26,28)/b20-18+ |
| InChIKey | IOVMJVLDGSKKQV-CZIZESTLSA-N |
| XLogP | 4.51 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|