C32H27N5O — CID 101291633
2-[4-[4-[bis(3-phenylpropyl)amino]phenyl]-3-cyano-5-oxopyrrol-2-ylidene]propanedinitrile (PubChem CID 101291633) has the molecular formula C32H27N5O and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[4-[4-[bis(3-phenylpropyl)amino]phenyl]-3-cyano-5-oxopyrrol-2-ylidene]propanedinitrile.
| Compound Name | 2-[4-[4-[bis(3-phenylpropyl)amino]phenyl]-3-cyano-5-oxopyrrol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 101291633 |
| Molecular Formula | C32H27N5O |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 2-[4-[4-[bis(3-phenylpropyl)amino]phenyl]-3-cyano-5-oxopyrrol-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1NC(=O)C(c2ccc(N(CCCc3ccccc3)CCCc3ccccc3)cc2)=C1C#N |
| InChI | InChI=1S/C32H27N5O/c33-21-27(22-34)31-29(23-35)30(32(38)36-31)26-15-17-28(18-16-26)37(19-7-13-24-9-3-1-4-10-24)20-8-14-25-11-5-2-6-12-25/h1-6,9-12,15-18H,7-8,13-14,19-20H2,(H,36,38) |
| InChIKey | XPADTIHVVAKKLT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|