C26H31N5O — CID 102500049
2-[3-cyano-4-[4-(dihexylamino)phenyl]-5-oxopyrrol-2-ylidene]propanedinitrile (PubChem CID 102500049) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[3-cyano-4-[4-(dihexylamino)phenyl]-5-oxopyrrol-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[4-(dihexylamino)phenyl]-5-oxopyrrol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102500049 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 2-[3-cyano-4-[4-(dihexylamino)phenyl]-5-oxopyrrol-2-ylidene]propanedinitrile |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C2=C(C#N)C(=C(C#N)C#N)NC2=O)cc1 |
| InChI | InChI=1S/C26H31N5O/c1-3-5-7-9-15-31(16-10-8-6-4-2)22-13-11-20(12-14-22)24-23(19-29)25(30-26(24)32)21(17-27)18-28/h11-14H,3-10,15-16H2,1-2H3,(H,30,32) |
| InChIKey | KIDPTRMPHOXIID-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|