C22H27N3O2 — CID 11371998
(5Z)-5-[[4-(dibutylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 11371998) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (5Z)-5-[[4-(dibutylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[4-(dibutylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11371998 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (5Z)-5-[[4-(dibutylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=C2\C(=O)NC(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-4-6-12-25(13-7-5-2)18-10-8-17(9-11-18)14-19-16(3)20(15-23)22(27)24-21(19)26/h8-11,14H,4-7,12-13H2,1-3H3,(H,24,26,27)/b19-14- |
| InChIKey | AYUTZGCEENOGPT-RGEXLXHISA-N |
| XLogP | 3.97 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|