C20H17N3O — CID 139958454
4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carbonitrile (PubChem CID 139958454) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carbonitrile.
| Compound Name | 4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 139958454 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carbonitrile |
| SMILES | CN(C)c1ccc(C=C2C(=O)NC(c3ccccc3)=C2C#N)cc1 |
| InChI | InChI=1S/C20H17N3O/c1-23(2)16-10-8-14(9-11-16)12-17-18(13-21)19(22-20(17)24)15-6-4-3-5-7-15/h3-12H,1-2H3,(H,22,24) |
| InChIKey | UUEFDYRGVCWGRR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|