C33H44N4O2S — CID 146330180
(5Z)-5-[[2-(dioctylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 146330180) has the molecular formula C33H44N4O2S and a molecular weight of 560.81 g/mol. Its IUPAC name is (5Z)-5-[[2-(dioctylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[2-(dioctylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146330180 |
| Molecular Formula | C33H44N4O2S |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | (5Z)-5-[[2-(dioctylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCCCCCN(CCCCCCCC)c1nc(-c2ccccc2)c(/C=C2\C(=O)NC(=O)C(C#N)=C2C)s1 |
| InChI | InChI=1S/C33H44N4O2S/c1-4-6-8-10-12-17-21-37(22-18-13-11-9-7-5-2)33-35-30(26-19-15-14-16-20-26)29(40-33)23-27-25(3)28(24-34)32(39)36-31(27)38/h14-16,19-20,23H,4-13,17-18,21-22H2,1-3H3,(H,36,38,39)/b27-23- |
| InChIKey | ZGOBXCGRWNXMEQ-VYIQYICTSA-N |
| XLogP | 8.22 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|