C33H43N5O3S — CID 118582094
N-[(3Z)-3-[[2-[bis(3-methylbutyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]-N-methylbenzamide (PubChem CID 118582094) has the molecular formula C33H43N5O3S and a molecular weight of 589.81 g/mol. Its IUPAC name is N-[(3Z)-3-[[2-[bis(3-methylbutyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]-N-methylbenzamide.
| Compound Name | N-[(3Z)-3-[[2-[bis(3-methylbutyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 118582094 |
| Molecular Formula | C33H43N5O3S |
| Molecular Weight | 589.81 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | N-[(3Z)-3-[[2-[bis(3-methylbutyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]-N-methylbenzamide |
| SMILES | CC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)/C1=C\c1sc(N(CCC(C)C)CCC(C)C)nc1C(C)(C)C |
| InChI | InChI=1S/C33H43N5O3S/c1-21(2)15-17-37(18-16-22(3)4)32-35-28(33(6,7)8)27(42-32)19-25-23(5)26(20-34)31(41)38(30(25)40)36(9)29(39)24-13-11-10-12-14-24/h10-14,19,21-22H,15-18H2,1-9H3/b25-19- |
| InChIKey | WBAIHYSVYPHUHQ-PLRJNAJWSA-N |
| XLogP | 6.62 |
| TPSA | 97.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|