C32H56N4OS — CID 122630443
(4Z)-4-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-tert-butyl-2-methylpyrazol-3-one (PubChem CID 122630443) has the molecular formula C32H56N4OS and a molecular weight of 544.89 g/mol. Its IUPAC name is (4Z)-4-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-tert-butyl-2-methylpyrazol-3-one.
| Compound Name | (4Z)-4-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-tert-butyl-2-methylpyrazol-3-one |
|---|---|
| PubChem CID | 122630443 |
| Molecular Formula | C32H56N4OS |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.42 |
| IUPAC Name | (4Z)-4-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-5-tert-butyl-2-methylpyrazol-3-one |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(C(C)(C)C)c(/C=C2\C(=O)N(C)N=C2C(C)(C)C)s1 |
| InChI | InChI=1S/C32H56N4OS/c1-12-16-18-23(14-3)21-36(22-24(15-4)19-17-13-2)30-33-28(32(8,9)10)26(38-30)20-25-27(31(5,6)7)34-35(11)29(25)37/h20,23-24H,12-19,21-22H2,1-11H3/b25-20- |
| InChIKey | YCZGPYFBJXZSEC-QQTULTPQSA-N |
| XLogP | 8.94 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|