C28H46N6S2 — CID 177105842
4-tert-butyl-N,N-bis(2-ethylhexyl)-5-[(4-isocyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-1,3-thiazol-2-amine (PubChem CID 177105842) has the molecular formula C28H46N6S2 and a molecular weight of 530.85 g/mol. Its IUPAC name is 4-tert-butyl-N,N-bis(2-ethylhexyl)-5-[(4-isocyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-tert-butyl-N,N-bis(2-ethylhexyl)-5-[(4-isocyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 177105842 |
| Molecular Formula | C28H46N6S2 |
| Molecular Weight | 530.85 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | 4-tert-butyl-N,N-bis(2-ethylhexyl)-5-[(4-isocyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-1,3-thiazol-2-amine |
| SMILES | [C-]#[N+]c1c(C)nsc1N=Nc1sc(N(CC(CC)CCCC)CC(CC)CCCC)nc1C(C)(C)C |
| InChI | InChI=1S/C28H46N6S2/c1-10-14-16-21(12-3)18-34(19-22(13-4)17-15-11-2)27-30-24(28(6,7)8)26(35-27)32-31-25-23(29-9)20(5)33-36-25/h21-22H,10-19H2,1-8H3 |
| InChIKey | ZHILJYMFLYOSHX-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 58.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.85 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|