C41H63N7O3S2 — CID 136997044
ethyl 2-[[2-[bis(2-ethylhexyl)amino]-4-(2-methylbutanoylamino)-1,3-thiazol-5-yl]diazenyl]-5-[[4-(2-methylpropyl)phenyl]diazenyl]thiophene-3-carboxylate (PubChem CID 136997044) has the molecular formula C41H63N7O3S2 and a molecular weight of 766.14 g/mol. Its IUPAC name is ethyl 2-[[2-[bis(2-ethylhexyl)amino]-4-(2-methylbutanoylamino)-1,3-thiazol-5-yl]diazenyl]-5-[[4-(2-methylpropyl)phenyl]diazenyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[bis(2-ethylhexyl)amino]-4-(2-methylbutanoylamino)-1,3-thiazol-5-yl]diazenyl]-5-[[4-(2-methylpropyl)phenyl]diazenyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 136997044 |
| Molecular Formula | C41H63N7O3S2 |
| Molecular Weight | 766.14 g/mol |
| Exact Mass | 765.44 |
| IUPAC Name | ethyl 2-[[2-[bis(2-ethylhexyl)amino]-4-(2-methylbutanoylamino)-1,3-thiazol-5-yl]diazenyl]-5-[[4-(2-methylpropyl)phenyl]diazenyl]thiophene-3-carboxylate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(NC(=O)C(C)CC)c(N=Nc2sc(/N=N/c3ccc(CC(C)C)cc3)cc2C(=O)OCC)s1 |
| InChI | InChI=1S/C41H63N7O3S2/c1-10-16-18-30(13-4)26-48(27-31(14-5)19-17-11-2)41-43-36(42-37(49)29(9)12-3)39(53-41)47-46-38-34(40(50)51-15-6)25-35(52-38)45-44-33-22-20-32(21-23-33)24-28(7)8/h20-23,25,28-31H,10-19,24,26-27H2,1-9H3,(H,42,49)/b45-44+,47-46? |
| InChIKey | YEBGEDZEUGUQHS-MDTKHEPZSA-N |
| XLogP | 13.63 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.14 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|