C16H25NO3S — CID 92756718
ethyl 2-[[(2S)-2-methylpentanoyl]amino]-5-propan-2-ylthiophene-3-carboxylate (PubChem CID 92756718) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-methylpentanoyl]amino]-5-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2S)-2-methylpentanoyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 92756718 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | ethyl 2-[[(2S)-2-methylpentanoyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCC[C@H](C)C(=O)Nc1sc(C(C)C)cc1C(=O)OCC |
| InChI | InChI=1S/C16H25NO3S/c1-6-8-11(5)14(18)17-15-12(16(19)20-7-2)9-13(21-15)10(3)4/h9-11H,6-8H2,1-5H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | YINZFQNKEBSBCU-NSHDSACASA-N |
| XLogP | 4.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |