C21H26N2O3 — CID 136854630
ethyl 6-hydroxy-2,4-dimethyl-3-[[4-(2-methylpropyl)phenyl]diazenyl]benzoate (PubChem CID 136854630) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 6-hydroxy-2,4-dimethyl-3-[[4-(2-methylpropyl)phenyl]diazenyl]benzoate.
| Compound Name | ethyl 6-hydroxy-2,4-dimethyl-3-[[4-(2-methylpropyl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 136854630 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | ethyl 6-hydroxy-2,4-dimethyl-3-[[4-(2-methylpropyl)phenyl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1c(O)cc(C)c(/N=N/c2ccc(CC(C)C)cc2)c1C |
| InChI | InChI=1S/C21H26N2O3/c1-6-26-21(25)19-15(5)20(14(4)12-18(19)24)23-22-17-9-7-16(8-10-17)11-13(2)3/h7-10,12-13,24H,6,11H2,1-5H3/b23-22+ |
| InChIKey | ANHLKYWNIWZGEC-GHVJWSGMSA-N |
| XLogP | 5.80 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|