C24H22Cl2O3 — CID 25256946
ethyl 3-[bis(4-chlorophenyl)methyl]-6-hydroxy-2,4-dimethylbenzoate (PubChem CID 25256946) has the molecular formula C24H22Cl2O3 and a molecular weight of 429.34 g/mol. Its IUPAC name is ethyl 3-[bis(4-chlorophenyl)methyl]-6-hydroxy-2,4-dimethylbenzoate.
| Compound Name | ethyl 3-[bis(4-chlorophenyl)methyl]-6-hydroxy-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 25256946 |
| Molecular Formula | C24H22Cl2O3 |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | ethyl 3-[bis(4-chlorophenyl)methyl]-6-hydroxy-2,4-dimethylbenzoate |
| SMILES | CCOC(=O)c1c(O)cc(C)c(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C24H22Cl2O3/c1-4-29-24(28)22-15(3)21(14(2)13-20(22)27)23(16-5-9-18(25)10-6-16)17-7-11-19(26)12-8-17/h5-13,23,27H,4H2,1-3H3 |
| InChIKey | LDBRDLNJJNFZDZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|