C23H22O3 — CID 102283436
methyl 3-benzhydryl-6-hydroxy-2,4-dimethylbenzoate (PubChem CID 102283436) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl 3-benzhydryl-6-hydroxy-2,4-dimethylbenzoate.
| Compound Name | methyl 3-benzhydryl-6-hydroxy-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 102283436 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl 3-benzhydryl-6-hydroxy-2,4-dimethylbenzoate |
| SMILES | COC(=O)c1c(O)cc(C)c(C(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C23H22O3/c1-15-14-19(24)21(23(25)26-3)16(2)20(15)22(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-14,22,24H,1-3H3 |
| InChIKey | HUDFWXPIBRGOGC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|